| Mineral chemical composition | Description | Mineral/chemical composition | Description |
| Albite NaAlSi3O8 | Sodium Plagioclase feldspar. Magmatic and pegmatitic rocks. | Manasseite Mg6Al2(CO3)(OH)16∙4(H2O) | In iron ore skarns. |
| Anatase TiO2 | Derived from other Ti-bearing minerals. Common as a detrital mineral | Microcline KAlSi3O8 | Granitic gmatites hydrothermal and, metamorphic rocks. |
| Artroeite PbAlF3(OH)2 | In a quartz-lined vug | Montmorillonite NaCaAl2Si4O10(OH)2(H2O)10 | Absorbing water and expanding. |
| Augite-a pyroxene (Ca, Na)(Mg, Fe, Al, Ti)(Si, Al)2O6 | Ferromagnesian silicate. Basic igneous and metamorphic rocks. | Mullite Al6Si2O13 | Remelted Tertiary-aged clays. |
| Biotite-Black mica K(MgFe2+)3AlSi3O10(OH, F)2 | Granitic rocks. Forms a series with phlogopite. | Muscovite KAl2(Si3Al)O10(OH, F)2 | Granites and pegmatites. |
| Calcite CaCo3 | Found in all kind of rocks | Nontronite Na(Fe3+)2Si3AlO10(OH)2∙4(H2O) | It is the iron(III) rich member of the smectite group of clay meminerals. |
| Clinochlore (MgFe2+)5Si3Al2O10(OH)8 | Alteration mineral. Metamorphic rock. | Pargasite NaCa2Mg3(Fe2+)Si6Al3O22(OH)2 | A complex inosilicate mineral of the amphibole group. |
| Diopside CaMg(Si2O6) | Basic and ultrabasic igneous and metamorphic rocks. | Quartz (SiO2) | It is a component of almost every rock type. |
| Ferroactinolite Ca2(Fe2+)5(Si8O22)(OH)2 | Prismatic crystals of ferro-actinolite showing terminal crystal faces | Riebeckite Na2(Fe2+)3(Fe3+)2(Si8O22)(OH)2 | A sodium-rich member of the amphibole group of silicate mine. |
| Fluorite CaF2 | Low temperature vein deposits. | Saponite CaNa(MgFe2+)3Si3AlO10(OH)2∙4H2O) | Amygdaloidal cavities in basalts. |
| Gypsum Ca(SO4)∙2(H2O) | Sedimentary evaporite deposits | Zaherite Al12(SO4)5(OH)26∙20(H2O) | In a massive kaolinite-boehmite rock. |
| Kaolinite Al2Si2O5(OH)4 | Secondary mineral derived from the weathering of alumino-silicate minerals. | Zircon ZrSiO4 | Zircon is a mineral (group of nesosilicates). |
| Magnetite (Fe3+)2(Fe2+)O4 | Common mineral in igneous, metamorphic rocks, known as lodestone |
| |